C25H19F5O — CID 139884143
2-butyl-1,9-difluoro-7-[4-(trifluoromethoxy)phenyl]phenanthrene (PubChem CID 139884143) has the molecular formula C25H19F5O and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-butyl-1,9-difluoro-7-[4-(trifluoromethoxy)phenyl]phenanthrene.
| Compound Name | 2-butyl-1,9-difluoro-7-[4-(trifluoromethoxy)phenyl]phenanthrene |
|---|---|
| PubChem CID | 139884143 |
| Molecular Formula | C25H19F5O |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-butyl-1,9-difluoro-7-[4-(trifluoromethoxy)phenyl]phenanthrene |
| SMILES | CCCCc1ccc2c(cc(F)c3cc(-c4ccc(OC(F)(F)F)cc4)ccc32)c1F |
| InChI | InChI=1S/C25H19F5O/c1-2-3-4-16-7-11-20-19-12-8-17(13-21(19)23(26)14-22(20)24(16)27)15-5-9-18(10-6-15)31-25(28,29)30/h5-14H,2-4H2,1H3 |
| InChIKey | ACLDHENSQVEECE-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|