C30H37N5O5 — CID 139885070
6-amino-2-[[2-[(4-benzoylpiperidine-1-carbonyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 139885070) has the molecular formula C30H37N5O5 and a molecular weight of 547.66 g/mol. Its IUPAC name is 6-amino-2-[[2-[(4-benzoylpiperidine-1-carbonyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[(4-benzoylpiperidine-1-carbonyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 139885070 |
| Molecular Formula | C30H37N5O5 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 6-amino-2-[[2-[(4-benzoylpiperidine-1-carbonyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)N1CCC(C(=O)c2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C30H37N5O5/c31-15-7-6-12-25(29(38)39)33-28(37)26(18-22-19-32-24-11-5-4-10-23(22)24)34-30(40)35-16-13-21(14-17-35)27(36)20-8-2-1-3-9-20/h1-5,8-11,19,21,25-26,32H,6-7,12-18,31H2,(H,33,37)(H,34,40)(H,38,39) |
| InChIKey | ANUJJCYDVBRTSP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|