C12H8ClN5 — CID 139885477
N-(4-chlorophenyl)pyrimido[5,4-d]pyrimidin-4-amine (PubChem CID 139885477) has the molecular formula C12H8ClN5 and a molecular weight of 257.68 g/mol. Its IUPAC name is N-(4-chlorophenyl)pyrimido[5,4-d]pyrimidin-4-amine.
| Compound Name | N-(4-chlorophenyl)pyrimido[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139885477 |
| Molecular Formula | C12H8ClN5 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-(4-chlorophenyl)pyrimido[5,4-d]pyrimidin-4-amine |
| SMILES | Clc1ccc(Nc2ncnc3cncnc23)cc1 |
| InChI | InChI=1S/C12H8ClN5/c13-8-1-3-9(4-2-8)18-12-11-10(15-7-17-12)5-14-6-16-11/h1-7H,(H,15,17,18) |
| InChIKey | ALIQRYGLAKNBLI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |