C6H5ClN2OS — CID 139890406
(2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methanol (PubChem CID 139890406) has the molecular formula C6H5ClN2OS and a molecular weight of 188.64 g/mol. Its IUPAC name is (2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methanol.
| Compound Name | (2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methanol |
|---|---|
| PubChem CID | 139890406 |
| Molecular Formula | C6H5ClN2OS |
| Molecular Weight | 188.64 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | (2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methanol |
| SMILES | OCc1cn2cc(Cl)sc2n1 |
| InChI | InChI=1S/C6H5ClN2OS/c7-5-2-9-1-4(3-10)8-6(9)11-5/h1-2,10H,3H2 |
| InChIKey | HSZQQFTWCYXAFY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.64 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |