C13H20N2O3 — CID 139893688
1-(methylamino)ethyl (E)-3-(3-ethenyl-2-oxopyrrolidin-1-yl)-2-methylprop-2-enoate (PubChem CID 139893688) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-(methylamino)ethyl (E)-3-(3-ethenyl-2-oxopyrrolidin-1-yl)-2-methylprop-2-enoate.
| Compound Name | 1-(methylamino)ethyl (E)-3-(3-ethenyl-2-oxopyrrolidin-1-yl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139893688 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-(methylamino)ethyl (E)-3-(3-ethenyl-2-oxopyrrolidin-1-yl)-2-methylprop-2-enoate |
| SMILES | C=CC1CCN(/C=C(\C)C(=O)OC(C)NC)C1=O |
| InChI | InChI=1S/C13H20N2O3/c1-5-11-6-7-15(12(11)16)8-9(2)13(17)18-10(3)14-4/h5,8,10-11,14H,1,6-7H2,2-4H3/b9-8+ |
| InChIKey | TUEIZSOQJCYRTG-CMDGGOBGSA-N |
| XLogP | 1.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|