C13H17NO5 — CID 158477857
ethenyl acetate;3-(3-ethenyl-2-oxopyrrolidin-1-yl)prop-2-enoic acid (PubChem CID 158477857) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is ethenyl acetate;3-(3-ethenyl-2-oxopyrrolidin-1-yl)prop-2-enoic acid.
| Compound Name | ethenyl acetate;3-(3-ethenyl-2-oxopyrrolidin-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 158477857 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethenyl acetate;3-(3-ethenyl-2-oxopyrrolidin-1-yl)prop-2-enoic acid |
| SMILES | C=CC1CCN(C=CC(=O)O)C1=O.C=COC(C)=O |
| InChI | InChI=1S/C9H11NO3.C4H6O2/c1-2-7-3-5-10(9(7)13)6-4-8(11)12;1-3-6-4(2)5/h2,4,6-7H,1,3,5H2,(H,11,12);3H,1H2,2H3 |
| InChIKey | HHDQNVJMMAAUIW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|