C20H16N4S3 — CID 139905758
4-(2-methylsulfanylthiophen-3-yl)-N-(4-phenyldiazenylphenyl)-1,3-thiazol-2-amine (PubChem CID 139905758) has the molecular formula C20H16N4S3 and a molecular weight of 408.58 g/mol. Its IUPAC name is 4-(2-methylsulfanylthiophen-3-yl)-N-(4-phenyldiazenylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-methylsulfanylthiophen-3-yl)-N-(4-phenyldiazenylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 139905758 |
| Molecular Formula | C20H16N4S3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 4-(2-methylsulfanylthiophen-3-yl)-N-(4-phenyldiazenylphenyl)-1,3-thiazol-2-amine |
| SMILES | CSc1sccc1-c1csc(Nc2ccc(/N=N/c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C20H16N4S3/c1-25-19-17(11-12-26-19)18-13-27-20(22-18)21-14-7-9-16(10-8-14)24-23-15-5-3-2-4-6-15/h2-13H,1H3,(H,21,22)/b24-23+ |
| InChIKey | IQTXSTFQWYHXFV-WCWDXBQESA-N |
| XLogP | 7.75 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|