C19H28N2O2 — CID 139905837
N-cyclohexyl-5-[(cyclohexylamino)-hydroxymethylidene]cyclopenta-1,3-diene-1-carboxamide (PubChem CID 139905837) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is N-cyclohexyl-5-[(cyclohexylamino)-hydroxymethylidene]cyclopenta-1,3-diene-1-carboxamide.
| Compound Name | N-cyclohexyl-5-[(cyclohexylamino)-hydroxymethylidene]cyclopenta-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 139905837 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-cyclohexyl-5-[(cyclohexylamino)-hydroxymethylidene]cyclopenta-1,3-diene-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1=CC=CC1=C(O)NC1CCCCC1 |
| InChI | InChI=1S/C19H28N2O2/c22-18(20-14-8-3-1-4-9-14)16-12-7-13-17(16)19(23)21-15-10-5-2-6-11-15/h7,12-15,20,22H,1-6,8-11H2,(H,21,23) |
| InChIKey | UQSSTHYSMDDRCZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|