C4HN3O6S2 — CID 139909658
3,4,5-trinitrothiophene-2-thiol (PubChem CID 139909658) has the molecular formula C4HN3O6S2 and a molecular weight of 251.20 g/mol. Its IUPAC name is 3,4,5-trinitrothiophene-2-thiol.
| Compound Name | 3,4,5-trinitrothiophene-2-thiol |
|---|---|
| PubChem CID | 139909658 |
| Molecular Formula | C4HN3O6S2 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 250.93 |
| IUPAC Name | 3,4,5-trinitrothiophene-2-thiol |
| SMILES | O=[N+]([O-])c1sc(S)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C4HN3O6S2/c8-5(9)1-2(6(10)11)4(14)15-3(1)7(12)13/h14H |
| InChIKey | QOFGZKIECJTAHI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|