C21H24N4O3 — CID 139916092
6-(2-cyclopropyl-7-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-9-yl)hexanoic acid (PubChem CID 139916092) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 6-(2-cyclopropyl-7-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-9-yl)hexanoic acid.
| Compound Name | 6-(2-cyclopropyl-7-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-9-yl)hexanoic acid |
|---|---|
| PubChem CID | 139916092 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 6-(2-cyclopropyl-7-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-9-yl)hexanoic acid |
| SMILES | Cc1ccnc2c1N(CCCCCC(=O)O)C(=O)c1cccnc1N2C1CC1 |
| InChI | InChI=1S/C21H24N4O3/c1-14-10-12-23-20-18(14)24(13-4-2-3-7-17(26)27)21(28)16-6-5-11-22-19(16)25(20)15-8-9-15/h5-6,10-12,15H,2-4,7-9,13H2,1H3,(H,26,27) |
| InChIKey | VZWSGPKZSWDJDG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|