C31H33ClN8O2 — CID 162007530
2-chloro-4-methylpyridin-3-amine;2-(cyclopropylamino)pyridine-3-carboxamide;2-cyclopropyl-12-methyl-2,4,15-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one (PubChem CID 162007530) has the molecular formula C31H33ClN8O2 and a molecular weight of 585.11 g/mol. Its IUPAC name is 2-chloro-4-methylpyridin-3-amine;2-(cyclopropylamino)pyridine-3-carboxamide;2-cyclopropyl-12-methyl-2,4,15-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one.
| Compound Name | 2-chloro-4-methylpyridin-3-amine;2-(cyclopropylamino)pyridine-3-carboxamide;2-cyclopropyl-12-methyl-2,4,15-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
|---|---|
| PubChem CID | 162007530 |
| Molecular Formula | C31H33ClN8O2 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 2-chloro-4-methylpyridin-3-amine;2-(cyclopropylamino)pyridine-3-carboxamide;2-cyclopropyl-12-methyl-2,4,15-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
| SMILES | Cc1ccnc(Cl)c1N.Cc1ccnc2c1CC(=O)c1cccnc1N2C1CC1.NC(=O)c1cccnc1NC1CC1 |
| InChI | InChI=1S/C16H15N3O.C9H11N3O.C6H7ClN2/c1-10-6-8-18-16-13(10)9-14(20)12-3-2-7-17-15(12)19(16)11-4-5-11;10-8(13)7-2-1-5-11-9(7)12-6-3-4-6;1-4-2-3-9-6(7)5(4)8/h2-3,6-8,11H,4-5,9H2,1H3;1-2,5-6H,3-4H2,(H2,10,13)(H,11,12);2-3H,8H2,1H3 |
| InChIKey | YTANMMDJFNZWGX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|