C27H34F2O8 — CID 139917457
(2R)-4-[[(4R)-4-carboxy-1-(4-fluorophenoxy)hexan-2-yl]oxymethoxy]-2-ethyl-5-(4-fluorophenoxy)pentanoic acid (PubChem CID 139917457) has the molecular formula C27H34F2O8 and a molecular weight of 524.56 g/mol. Its IUPAC name is (2R)-4-[[(4R)-4-carboxy-1-(4-fluorophenoxy)hexan-2-yl]oxymethoxy]-2-ethyl-5-(4-fluorophenoxy)pentanoic acid.
| Compound Name | (2R)-4-[[(4R)-4-carboxy-1-(4-fluorophenoxy)hexan-2-yl]oxymethoxy]-2-ethyl-5-(4-fluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 139917457 |
| Molecular Formula | C27H34F2O8 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (2R)-4-[[(4R)-4-carboxy-1-(4-fluorophenoxy)hexan-2-yl]oxymethoxy]-2-ethyl-5-(4-fluorophenoxy)pentanoic acid |
| SMILES | CC[C@H](CC(COc1ccc(F)cc1)OCOC(COc1ccc(F)cc1)C[C@@H](CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H34F2O8/c1-3-18(26(30)31)13-24(15-34-22-9-5-20(28)6-10-22)36-17-37-25(14-19(4-2)27(32)33)16-35-23-11-7-21(29)8-12-23/h5-12,18-19,24-25H,3-4,13-17H2,1-2H3,(H,30,31)(H,32,33)/t18-,19-,24?,25?/m1/s1 |
| InChIKey | JUSHSZHZGKPBPX-WWVRUBFXSA-N |
| XLogP | 5.15 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|