C20H28O2 — CID 139920993
2-methylidene-1-(4-pentoxy-5,6,7,8-tetrahydronaphthalen-1-yl)butan-1-one (PubChem CID 139920993) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 2-methylidene-1-(4-pentoxy-5,6,7,8-tetrahydronaphthalen-1-yl)butan-1-one.
| Compound Name | 2-methylidene-1-(4-pentoxy-5,6,7,8-tetrahydronaphthalen-1-yl)butan-1-one |
|---|---|
| PubChem CID | 139920993 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 2-methylidene-1-(4-pentoxy-5,6,7,8-tetrahydronaphthalen-1-yl)butan-1-one |
| SMILES | C=C(CC)C(=O)c1ccc(OCCCCC)c2c1CCCC2 |
| InChI | InChI=1S/C20H28O2/c1-4-6-9-14-22-19-13-12-18(20(21)15(3)5-2)16-10-7-8-11-17(16)19/h12-13H,3-11,14H2,1-2H3 |
| InChIKey | KEWNKJJYZVETAM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|