C23H32N2O2 — CID 139924559
2-methyl-3-(5-methylimidazol-1-yl)-1-(4-pentoxy-5,6,7,8-tetrahydronaphthalen-1-yl)propan-1-one (PubChem CID 139924559) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-methyl-3-(5-methylimidazol-1-yl)-1-(4-pentoxy-5,6,7,8-tetrahydronaphthalen-1-yl)propan-1-one.
| Compound Name | 2-methyl-3-(5-methylimidazol-1-yl)-1-(4-pentoxy-5,6,7,8-tetrahydronaphthalen-1-yl)propan-1-one |
|---|---|
| PubChem CID | 139924559 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-methyl-3-(5-methylimidazol-1-yl)-1-(4-pentoxy-5,6,7,8-tetrahydronaphthalen-1-yl)propan-1-one |
| SMILES | CCCCCOc1ccc(C(=O)C(C)Cn2cncc2C)c2c1CCCC2 |
| InChI | InChI=1S/C23H32N2O2/c1-4-5-8-13-27-22-12-11-21(19-9-6-7-10-20(19)22)23(26)17(2)15-25-16-24-14-18(25)3/h11-12,14,16-17H,4-10,13,15H2,1-3H3 |
| InChIKey | ZKENDHUYCLPMPF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|