C24H24F3NO4 — CID 139921892
3-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]propanoic acid (PubChem CID 139921892) has the molecular formula C24H24F3NO4 and a molecular weight of 447.45 g/mol. Its IUPAC name is 3-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139921892 |
| Molecular Formula | C24H24F3NO4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]propanoic acid |
| SMILES | CCCCOc1cc(C(F)(F)F)nc2ccc(COc3ccccc3CCC(=O)O)cc12 |
| InChI | InChI=1S/C24H24F3NO4/c1-2-3-12-31-21-14-22(24(25,26)27)28-19-10-8-16(13-18(19)21)15-32-20-7-5-4-6-17(20)9-11-23(29)30/h4-8,10,13-14H,2-3,9,11-12,15H2,1H3,(H,29,30) |
| InChIKey | LRBKXFNPIYOXGQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|