C23H22F3NO4 — CID 139921898
2-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]acetic acid (PubChem CID 139921898) has the molecular formula C23H22F3NO4 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 139921898 |
| Molecular Formula | C23H22F3NO4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-[2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]acetic acid |
| SMILES | CCCCOc1cc(C(F)(F)F)nc2ccc(COc3ccccc3CC(=O)O)cc12 |
| InChI | InChI=1S/C23H22F3NO4/c1-2-3-10-30-20-13-21(23(24,25)26)27-18-9-8-15(11-17(18)20)14-31-19-7-5-4-6-16(19)12-22(28)29/h4-9,11,13H,2-3,10,12,14H2,1H3,(H,28,29) |
| InChIKey | VUHNOTAQJRZZPS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|