C20H22N2O6 — CID 139941577
2-cyclohexyl-2-(6,6-dinitrocyclohexa-2,4-dien-1-yl)oxy-1-phenylethanone (PubChem CID 139941577) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-cyclohexyl-2-(6,6-dinitrocyclohexa-2,4-dien-1-yl)oxy-1-phenylethanone.
| Compound Name | 2-cyclohexyl-2-(6,6-dinitrocyclohexa-2,4-dien-1-yl)oxy-1-phenylethanone |
|---|---|
| PubChem CID | 139941577 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-cyclohexyl-2-(6,6-dinitrocyclohexa-2,4-dien-1-yl)oxy-1-phenylethanone |
| SMILES | O=C(c1ccccc1)C(OC1C=CC=CC1([N+](=O)[O-])[N+](=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C20H22N2O6/c23-18(15-9-3-1-4-10-15)19(16-11-5-2-6-12-16)28-17-13-7-8-14-20(17,21(24)25)22(26)27/h1,3-4,7-10,13-14,16-17,19H,2,5-6,11-12H2 |
| InChIKey | AUYJDRWAFXHWQT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|