C16H28S6 — CID 139970558
2-[[3,5-bis(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol (PubChem CID 139970558) has the molecular formula C16H28S6 and a molecular weight of 412.80 g/mol. Its IUPAC name is 2-[[3,5-bis(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol.
| Compound Name | 2-[[3,5-bis(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol |
|---|---|
| PubChem CID | 139970558 |
| Molecular Formula | C16H28S6 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-[[3,5-bis(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol |
| SMILES | SCCSC12CC3CC(SCCS)(C1)CC(SCCS)(C3)C2 |
| InChI | InChI=1S/C16H28S6/c17-1-4-20-14-7-13-8-15(10-14,21-5-2-18)12-16(9-13,11-14)22-6-3-19/h13,17-19H,1-12H2 |
| InChIKey | RINZXURIQNORHK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|