C18H32S8 — CID 158025081
2-[[3,5,7-tris(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol (PubChem CID 158025081) has the molecular formula C18H32S8 and a molecular weight of 504.99 g/mol. Its IUPAC name is 2-[[3,5,7-tris(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol.
| Compound Name | 2-[[3,5,7-tris(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol |
|---|---|
| PubChem CID | 158025081 |
| Molecular Formula | C18H32S8 |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 2-[[3,5,7-tris(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol |
| SMILES | SCCSC12CC3(SCCS)CC(SCCS)(C1)CC(SCCS)(C2)C3 |
| InChI | InChI=1S/C18H32S8/c19-1-5-23-15-9-16(24-6-2-20)12-17(10-15,25-7-3-21)14-18(11-15,13-16)26-8-4-22/h19-22H,1-14H2 |
| InChIKey | FGMYLJHGUILFET-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|