C18H32S6 — CID 139970532
2-[2-[[3-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1-adamantyl]sulfanyl]ethylsulfanyl]ethanethiol (PubChem CID 139970532) has the molecular formula C18H32S6 and a molecular weight of 440.86 g/mol. Its IUPAC name is 2-[2-[[3-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1-adamantyl]sulfanyl]ethylsulfanyl]ethanethiol.
| Compound Name | 2-[2-[[3-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1-adamantyl]sulfanyl]ethylsulfanyl]ethanethiol |
|---|---|
| PubChem CID | 139970532 |
| Molecular Formula | C18H32S6 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[2-[[3-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1-adamantyl]sulfanyl]ethylsulfanyl]ethanethiol |
| SMILES | SCCSCCSC12CC3CC(C1)CC(SCCSCCS)(C3)C2 |
| InChI | InChI=1S/C18H32S6/c19-1-3-21-5-7-23-17-10-15-9-16(11-17)13-18(12-15,14-17)24-8-6-22-4-2-20/h15-16,19-20H,1-14H2 |
| InChIKey | SPKSZSCZEQSWLT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|