C22H40S9 — CID 139970557
2-[2-[[3,5-bis[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1-adamantyl]sulfanyl]ethylsulfanyl]ethanethiol (PubChem CID 139970557) has the molecular formula C22H40S9 and a molecular weight of 593.17 g/mol. Its IUPAC name is 2-[2-[[3,5-bis[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1-adamantyl]sulfanyl]ethylsulfanyl]ethanethiol.
| Compound Name | 2-[2-[[3,5-bis[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1-adamantyl]sulfanyl]ethylsulfanyl]ethanethiol |
|---|---|
| PubChem CID | 139970557 |
| Molecular Formula | C22H40S9 |
| Molecular Weight | 593.17 g/mol |
| Exact Mass | 592.06 |
| IUPAC Name | 2-[2-[[3,5-bis[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1-adamantyl]sulfanyl]ethylsulfanyl]ethanethiol |
| SMILES | SCCSCCSC12CC3CC(SCCSCCS)(C1)CC(SCCSCCS)(C3)C2 |
| InChI | InChI=1S/C22H40S9/c23-1-4-26-7-10-29-20-13-19-14-21(16-20,30-11-8-27-5-2-24)18-22(15-19,17-20)31-12-9-28-6-3-25/h19,23-25H,1-18H2 |
| InChIKey | PPEIQEPHRNWGKX-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.17 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|