C16H28S4 — CID 139982570
2-[[3,5-dimethyl-7-(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol (PubChem CID 139982570) has the molecular formula C16H28S4 and a molecular weight of 348.67 g/mol. Its IUPAC name is 2-[[3,5-dimethyl-7-(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol.
| Compound Name | 2-[[3,5-dimethyl-7-(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol |
|---|---|
| PubChem CID | 139982570 |
| Molecular Formula | C16H28S4 |
| Molecular Weight | 348.67 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[[3,5-dimethyl-7-(2-sulfanylethylsulfanyl)-1-adamantyl]sulfanyl]ethanethiol |
| SMILES | CC12CC3(C)CC(SCCS)(C1)CC(SCCS)(C2)C3 |
| InChI | InChI=1S/C16H28S4/c1-13-7-14(2)10-15(8-13,19-5-3-17)12-16(9-13,11-14)20-6-4-18/h17-18H,3-12H2,1-2H3 |
| InChIKey | ZOCAYXSBECTTDB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|