C15H9F17N2O3S2 — CID 139974875
[3,3-dicyanoprop-2-enyl(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 139974875) has the molecular formula C15H9F17N2O3S2 and a molecular weight of 652.35 g/mol. Its IUPAC name is [3,3-dicyanoprop-2-enyl(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | [3,3-dicyanoprop-2-enyl(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 139974875 |
| Molecular Formula | C15H9F17N2O3S2 |
| Molecular Weight | 652.35 g/mol |
| Exact Mass | 651.98 |
| IUPAC Name | [3,3-dicyanoprop-2-enyl(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | CS(C)(CC=C(C#N)C#N)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H9F17N2O3S2/c1-38(2,4-3-7(5-33)6-34)37-39(35,36)15(31,32)13(26,27)11(22,23)9(18,19)8(16,17)10(20,21)12(24,25)14(28,29)30/h3H,4H2,1-2H3 |
| InChIKey | XUQZFJGRZKBPTF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.35 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|