C16H15ClN4S — CID 139987696
N-[(2-chlorophenyl)methylideneamino]-6-propan-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 139987696) has the molecular formula C16H15ClN4S and a molecular weight of 330.84 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-6-propan-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-6-propan-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139987696 |
| Molecular Formula | C16H15ClN4S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-6-propan-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)c1cc2c(NN=Cc3ccccc3Cl)ncnc2s1 |
| InChI | InChI=1S/C16H15ClN4S/c1-10(2)14-7-12-15(18-9-19-16(12)22-14)21-20-8-11-5-3-4-6-13(11)17/h3-10H,1-2H3,(H,18,19,21) |
| InChIKey | CCDXFRSEVFLSTL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|