C17H17IN4O2S — CID 142269639
2-iodo-6-methoxy-4-[[(6-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol (PubChem CID 142269639) has the molecular formula C17H17IN4O2S and a molecular weight of 468.32 g/mol. Its IUPAC name is 2-iodo-6-methoxy-4-[[(6-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-iodo-6-methoxy-4-[[(6-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 142269639 |
| Molecular Formula | C17H17IN4O2S |
| Molecular Weight | 468.32 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 2-iodo-6-methoxy-4-[[(6-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(C=NNc2ncnc3sc(C(C)C)cc23)cc(I)c1O |
| InChI | InChI=1S/C17H17IN4O2S/c1-9(2)14-6-11-16(19-8-20-17(11)25-14)22-21-7-10-4-12(18)15(23)13(5-10)24-3/h4-9,23H,1-3H3,(H,19,20,22) |
| InChIKey | BIVCPWODNXICJV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|