C13H13N5S2 — CID 139987673
6-propan-2-yl-N-(1,3-thiazol-5-ylmethylideneamino)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 139987673) has the molecular formula C13H13N5S2 and a molecular weight of 303.42 g/mol. Its IUPAC name is 6-propan-2-yl-N-(1,3-thiazol-5-ylmethylideneamino)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-propan-2-yl-N-(1,3-thiazol-5-ylmethylideneamino)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139987673 |
| Molecular Formula | C13H13N5S2 |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 6-propan-2-yl-N-(1,3-thiazol-5-ylmethylideneamino)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)c1cc2c(NN=Cc3cncs3)ncnc2s1 |
| InChI | InChI=1S/C13H13N5S2/c1-8(2)11-3-10-12(15-6-16-13(10)20-11)18-17-5-9-4-14-7-19-9/h3-8H,1-2H3,(H,15,16,18) |
| InChIKey | AACPZYIPHCGRHK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|