C22H27N5S — CID 75178763
6-tert-butyl-N-[(2-propan-2-yl-1,3-dihydroisoindol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 75178763) has the molecular formula C22H27N5S and a molecular weight of 393.56 g/mol. Its IUPAC name is 6-tert-butyl-N-[(2-propan-2-yl-1,3-dihydroisoindol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-N-[(2-propan-2-yl-1,3-dihydroisoindol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 75178763 |
| Molecular Formula | C22H27N5S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 6-tert-butyl-N-[(2-propan-2-yl-1,3-dihydroisoindol-5-yl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)N1Cc2ccc(C=NNc3ncnc4sc(C(C)(C)C)cc34)cc2C1 |
| InChI | InChI=1S/C22H27N5S/c1-14(2)27-11-16-7-6-15(8-17(16)12-27)10-25-26-20-18-9-19(22(3,4)5)28-21(18)24-13-23-20/h6-10,13-14H,11-12H2,1-5H3,(H,23,24,26) |
| InChIKey | RICLIYUJFDEGPN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|