C20H24FN5S — CID 139987573
6-tert-butyl-N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 139987573) has the molecular formula C20H24FN5S and a molecular weight of 385.51 g/mol. Its IUPAC name is 6-tert-butyl-N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139987573 |
| Molecular Formula | C20H24FN5S |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 6-tert-butyl-N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(C)Cc1ccc(C=NNc2ncnc3sc(C(C)(C)C)cc23)cc1F |
| InChI | InChI=1S/C20H24FN5S/c1-20(2,3)17-9-15-18(22-12-23-19(15)27-17)25-24-10-13-6-7-14(11-26(4)5)16(21)8-13/h6-10,12H,11H2,1-5H3,(H,22,23,25) |
| InChIKey | QKGSMNCYMWNGNH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|