C25H22N6O2S — CID 139987720
2-[[6-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-pyridinyl]methyl]isoindole-1,3-dione (PubChem CID 139987720) has the molecular formula C25H22N6O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is 2-[[6-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-pyridinyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[6-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-pyridinyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139987720 |
| Molecular Formula | C25H22N6O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[[6-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-pyridinyl]methyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)c1cc2c(NN=Cc3cccc(CN4C(=O)c5ccccc5C4=O)n3)ncnc2s1 |
| InChI | InChI=1S/C25H22N6O2S/c1-25(2,3)20-11-19-21(26-14-27-22(19)34-20)30-28-12-15-7-6-8-16(29-15)13-31-23(32)17-9-4-5-10-18(17)24(31)33/h4-12,14H,13H2,1-3H3,(H,26,27,30) |
| InChIKey | BJWNIOSGURMAKT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|