C22H28N6O2S2 — CID 139987613
6-tert-butyl-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 139987613) has the molecular formula C22H28N6O2S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is 6-tert-butyl-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139987613 |
| Molecular Formula | C22H28N6O2S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 6-tert-butyl-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(C=NNc3ncnc4sc(C(C)(C)C)cc34)cc2)CC1 |
| InChI | InChI=1S/C22H28N6O2S2/c1-22(2,3)19-13-18-20(23-15-24-21(18)31-19)26-25-14-16-5-7-17(8-6-16)32(29,30)28-11-9-27(4)10-12-28/h5-8,13-15H,9-12H2,1-4H3,(H,23,24,26) |
| InChIKey | YQNILUODYZIUPJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|