C26H23N5O2S — CID 139987704
2-[[4-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 139987704) has the molecular formula C26H23N5O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is 2-[[4-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139987704 |
| Molecular Formula | C26H23N5O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-[[4-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)c1cc2c(NN=Cc3ccc(CN4C(=O)c5ccccc5C4=O)cc3)ncnc2s1 |
| InChI | InChI=1S/C26H23N5O2S/c1-26(2,3)21-12-20-22(27-15-28-23(20)34-21)30-29-13-16-8-10-17(11-9-16)14-31-24(32)18-6-4-5-7-19(18)25(31)33/h4-13,15H,14H2,1-3H3,(H,27,28,30) |
| InChIKey | ZLUQENNYHWEVSW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|