C19H20N4O2S — CID 75178783
methyl 4-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]benzoate (PubChem CID 75178783) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is methyl 4-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 75178783 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | methyl 4-[[(6-tert-butylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNc2ncnc3sc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-19(2,3)15-9-14-16(20-11-21-17(14)26-15)23-22-10-12-5-7-13(8-6-12)18(24)25-4/h5-11H,1-4H3,(H,20,21,23) |
| InChIKey | XFRFTPGVNSJELE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|