C17H20N6S — CID 75054373
N-[[6-(aminomethyl)-2-pyridinyl]methylideneamino]-6-tert-butylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 75054373) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is N-[[6-(aminomethyl)-2-pyridinyl]methylideneamino]-6-tert-butylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[[6-(aminomethyl)-2-pyridinyl]methylideneamino]-6-tert-butylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 75054373 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[[6-(aminomethyl)-2-pyridinyl]methylideneamino]-6-tert-butylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)c1cc2c(NN=Cc3cccc(CN)n3)ncnc2s1 |
| InChI | InChI=1S/C17H20N6S/c1-17(2,3)14-7-13-15(19-10-20-16(13)24-14)23-21-9-12-6-4-5-11(8-18)22-12/h4-7,9-10H,8,18H2,1-3H3,(H,19,20,23) |
| InChIKey | ZZEPQDODGXTJFP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|