C15H26O3 — CID 139994697
6-pentyladamantane-1,3,5-triol (PubChem CID 139994697) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 6-pentyladamantane-1,3,5-triol.
| Compound Name | 6-pentyladamantane-1,3,5-triol |
|---|---|
| PubChem CID | 139994697 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 6-pentyladamantane-1,3,5-triol |
| SMILES | CCCCCC1C2CC3(O)CC(O)(C2)CC1(O)C3 |
| InChI | InChI=1S/C15H26O3/c1-2-3-4-5-12-11-6-13(16)8-14(17,7-11)10-15(12,18)9-13/h11-12,16-18H,2-10H2,1H3 |
| InChIKey | UQKARMSUZKCSGD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|