C30H31NO — CID 139997772
2-[N-[2,4-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-8-phenylnaphthalen-1-ol (PubChem CID 139997772) has the molecular formula C30H31NO and a molecular weight of 421.58 g/mol. Its IUPAC name is 2-[N-[2,4-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-8-phenylnaphthalen-1-ol.
| Compound Name | 2-[N-[2,4-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-8-phenylnaphthalen-1-ol |
|---|---|
| PubChem CID | 139997772 |
| Molecular Formula | C30H31NO |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[N-[2,4-di(propan-2-yl)phenyl]-C-methylcarbonimidoyl]-8-phenylnaphthalen-1-ol |
| SMILES | C/C(=N\c1ccc(C(C)C)cc1C(C)C)c1ccc2cccc(-c3ccccc3)c2c1O |
| InChI | InChI=1S/C30H31NO/c1-19(2)24-15-17-28(27(18-24)20(3)4)31-21(5)25-16-14-23-12-9-13-26(29(23)30(25)32)22-10-7-6-8-11-22/h6-20,32H,1-5H3/b31-21+ |
| InChIKey | AEJXPZKIYQNOQV-NJZRLIGZSA-N |
| XLogP | 8.60 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|