C21H38O — CID 139998284
6,10-diethyl-2,14-dimethylpentadeca-6,9-dien-8-one (PubChem CID 139998284) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is 6,10-diethyl-2,14-dimethylpentadeca-6,9-dien-8-one.
| Compound Name | 6,10-diethyl-2,14-dimethylpentadeca-6,9-dien-8-one |
|---|---|
| PubChem CID | 139998284 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | 6,10-diethyl-2,14-dimethylpentadeca-6,9-dien-8-one |
| SMILES | CCC(=CC(=O)C=C(CC)CCCC(C)C)CCCC(C)C |
| InChI | InChI=1S/C21H38O/c1-7-19(13-9-11-17(3)4)15-21(22)16-20(8-2)14-10-12-18(5)6/h15-18H,7-14H2,1-6H3 |
| InChIKey | AXXCNQZSEBDQMQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|