C22H34O4 — CID 14020837
(6R,7R)-7-[(1R,3S)-3-ethenyl-1-(methoxymethoxy)-3-methyl-4-oxohexyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one (PubChem CID 14020837) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (6R,7R)-7-[(1R,3S)-3-ethenyl-1-(methoxymethoxy)-3-methyl-4-oxohexyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one.
| Compound Name | (6R,7R)-7-[(1R,3S)-3-ethenyl-1-(methoxymethoxy)-3-methyl-4-oxohexyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 14020837 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (6R,7R)-7-[(1R,3S)-3-ethenyl-1-(methoxymethoxy)-3-methyl-4-oxohexyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
| SMILES | C=C[C@](C)(C[C@@H](OCOC)[C@@]1(C)C2=C(CCC2=O)CC[C@H]1C)C(=O)CC |
| InChI | InChI=1S/C22H34O4/c1-7-18(24)21(4,8-2)13-19(26-14-25-6)22(5)15(3)9-10-16-11-12-17(23)20(16)22/h8,15,19H,2,7,9-14H2,1,3-6H3/t15-,19-,21-,22+/m1/s1 |
| InChIKey | XPNSIXPLFJYLIN-PYYHNFOQSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|