C13H10Br2O3S — CID 14024562
1-(benzenesulfonylmethoxy)-2,4-dibromobenzene (PubChem CID 14024562) has the molecular formula C13H10Br2O3S and a molecular weight of 406.10 g/mol. Its IUPAC name is 1-(benzenesulfonylmethoxy)-2,4-dibromobenzene.
| Compound Name | 1-(benzenesulfonylmethoxy)-2,4-dibromobenzene |
|---|---|
| PubChem CID | 14024562 |
| Molecular Formula | C13H10Br2O3S |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.87 |
| IUPAC Name | 1-(benzenesulfonylmethoxy)-2,4-dibromobenzene |
| SMILES | O=S(=O)(COc1ccc(Br)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C13H10Br2O3S/c14-10-6-7-13(12(15)8-10)18-9-19(16,17)11-4-2-1-3-5-11/h1-8H,9H2 |
| InChIKey | HTOQGYDWFGGBEF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |