C30H32F3N3O2 — CID 140502320
(2S)-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 140502320) has the molecular formula C30H32F3N3O2 and a molecular weight of 523.60 g/mol. Its IUPAC name is (2S)-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140502320 |
| Molecular Formula | C30H32F3N3O2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (2S)-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCN2)cc1C1CCN(Cc2ccc(Oc3cc(F)c(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C30H32F3N3O2/c1-19-4-7-22(35-30(37)28-3-2-12-34-28)15-24(19)21-10-13-36(14-11-21)18-20-5-8-23(9-6-20)38-29-17-26(32)25(31)16-27(29)33/h4-9,15-17,21,28,34H,2-3,10-14,18H2,1H3,(H,35,37)/t28-/m0/s1 |
| InChIKey | BZAFTLPAHSXSCH-NDEPHWFRSA-N |
| XLogP | 6.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|