C23H30N2O4S — CID 24753167
methyl N-[3-[1-[(4-ethylsulfonylphenyl)methyl]piperidin-4-yl]-4-methylphenyl]carbamate (PubChem CID 24753167) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is methyl N-[3-[1-[(4-ethylsulfonylphenyl)methyl]piperidin-4-yl]-4-methylphenyl]carbamate.
| Compound Name | methyl N-[3-[1-[(4-ethylsulfonylphenyl)methyl]piperidin-4-yl]-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 24753167 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | methyl N-[3-[1-[(4-ethylsulfonylphenyl)methyl]piperidin-4-yl]-4-methylphenyl]carbamate |
| SMILES | CCS(=O)(=O)c1ccc(CN2CCC(c3cc(NC(=O)OC)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-4-30(27,28)21-9-6-18(7-10-21)16-25-13-11-19(12-14-25)22-15-20(8-5-17(22)2)24-23(26)29-3/h5-10,15,19H,4,11-14,16H2,1-3H3,(H,24,26) |
| InChIKey | DXIKMDVDOCMQFT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |