C32H36F3N3O2 — CID 140502338
1-methyl-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]piperidine-4-carboxamide (PubChem CID 140502338) has the molecular formula C32H36F3N3O2 and a molecular weight of 551.65 g/mol. Its IUPAC name is 1-methyl-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-methyl-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 140502338 |
| Molecular Formula | C32H36F3N3O2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 1-methyl-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(C)CC2)cc1C1CCN(Cc2ccc(Oc3cc(F)c(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C32H36F3N3O2/c1-21-3-6-25(36-32(39)24-9-13-37(2)14-10-24)17-27(21)23-11-15-38(16-12-23)20-22-4-7-26(8-5-22)40-31-19-29(34)28(33)18-30(31)35/h3-8,17-19,23-24H,9-16,20H2,1-2H3,(H,36,39) |
| InChIKey | QMSRMXKDBRVABF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|