C31H37F3N4O2 — CID 87738206
N-[2-(dimethylamino)ethyl-methylamino]-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]formamide (PubChem CID 87738206) has the molecular formula C31H37F3N4O2 and a molecular weight of 554.66 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl-methylamino]-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]formamide.
| Compound Name | N-[2-(dimethylamino)ethyl-methylamino]-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]formamide |
|---|---|
| PubChem CID | 87738206 |
| Molecular Formula | C31H37F3N4O2 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | N-[2-(dimethylamino)ethyl-methylamino]-N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]formamide |
| SMILES | Cc1ccc(N(C=O)N(C)CCN(C)C)cc1C1CCN(Cc2ccc(Oc3cc(F)c(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C31H37F3N4O2/c1-22-5-8-25(38(21-39)36(4)16-15-35(2)3)17-27(22)24-11-13-37(14-12-24)20-23-6-9-26(10-7-23)40-31-19-29(33)28(32)18-30(31)34/h5-10,17-19,21,24H,11-16,20H2,1-4H3 |
| InChIKey | DVZPBEPCFDAQCC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|