C33H31F3N2O3 — CID 69217729
benzyl N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]carbamate (PubChem CID 69217729) has the molecular formula C33H31F3N2O3 and a molecular weight of 560.62 g/mol. Its IUPAC name is benzyl N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]carbamate.
| Compound Name | benzyl N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 69217729 |
| Molecular Formula | C33H31F3N2O3 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | benzyl N-[4-methyl-3-[1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OCc2ccccc2)cc1C1CCN(Cc2ccc(Oc3cc(F)c(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C33H31F3N2O3/c1-22-7-10-26(37-33(39)40-21-24-5-3-2-4-6-24)17-28(22)25-13-15-38(16-14-25)20-23-8-11-27(12-9-23)41-32-19-30(35)29(34)18-31(32)36/h2-12,17-19,25H,13-16,20-21H2,1H3,(H,37,39) |
| InChIKey | MZYBALXYQDMADM-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|