C25H25F3N2O — CID 69218457
5-[1-[[4-(3,4-difluorophenoxy)phenyl]methyl]piperidin-4-yl]-2-fluoro-4-methylaniline (PubChem CID 69218457) has the molecular formula C25H25F3N2O and a molecular weight of 426.48 g/mol. Its IUPAC name is 5-[1-[[4-(3,4-difluorophenoxy)phenyl]methyl]piperidin-4-yl]-2-fluoro-4-methylaniline.
| Compound Name | 5-[1-[[4-(3,4-difluorophenoxy)phenyl]methyl]piperidin-4-yl]-2-fluoro-4-methylaniline |
|---|---|
| PubChem CID | 69218457 |
| Molecular Formula | C25H25F3N2O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 5-[1-[[4-(3,4-difluorophenoxy)phenyl]methyl]piperidin-4-yl]-2-fluoro-4-methylaniline |
| SMILES | Cc1cc(F)c(N)cc1C1CCN(Cc2ccc(Oc3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H25F3N2O/c1-16-12-24(28)25(29)14-21(16)18-8-10-30(11-9-18)15-17-2-4-19(5-3-17)31-20-6-7-22(26)23(27)13-20/h2-7,12-14,18H,8-11,15,29H2,1H3 |
| InChIKey | LZVGHXJPEPWOCX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|