C42H56 — CID 140522827
2,7-ditert-butyl-9-[(R)-(4-tert-butyl-2-methylcyclopentyl)-naphthalen-2-ylmethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 140522827) has the molecular formula C42H56 and a molecular weight of 560.91 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[(R)-(4-tert-butyl-2-methylcyclopentyl)-naphthalen-2-ylmethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[(R)-(4-tert-butyl-2-methylcyclopentyl)-naphthalen-2-ylmethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 140522827 |
| Molecular Formula | C42H56 |
| Molecular Weight | 560.91 g/mol |
| Exact Mass | 560.44 |
| IUPAC Name | 2,7-ditert-butyl-9-[(R)-(4-tert-butyl-2-methylcyclopentyl)-naphthalen-2-ylmethyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | CC1CC(C(C)(C)C)CC1[C@@H](c1ccc2ccccc2c1)C1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21 |
| InChI | InChI=1S/C42H56/c1-26-21-32(42(8,9)10)25-35(26)38(29-16-15-27-13-11-12-14-28(27)22-29)39-36-23-30(40(2,3)4)17-19-33(36)34-20-18-31(24-37(34)39)41(5,6)7/h11-20,22-24,26,32-39H,21,25H2,1-10H3/t26?,32?,33?,34?,35?,36?,37?,38-,39?/m1/s1 |
| InChIKey | LUQSWXAZZFOZPC-WFQVWNLSSA-N |
| XLogP | 11.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.91 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |