C45H70 — CID 162289561
3,6-ditert-butyl-9-[(R)-(4-tert-butyl-2-methylcyclopentyl)-(4-tert-butylphenyl)methyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene;propane (PubChem CID 162289561) has the molecular formula C45H70 and a molecular weight of 611.06 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[(R)-(4-tert-butyl-2-methylcyclopentyl)-(4-tert-butylphenyl)methyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene;propane.
| Compound Name | 3,6-ditert-butyl-9-[(R)-(4-tert-butyl-2-methylcyclopentyl)-(4-tert-butylphenyl)methyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene;propane |
|---|---|
| PubChem CID | 162289561 |
| Molecular Formula | C45H70 |
| Molecular Weight | 611.06 g/mol |
| Exact Mass | 610.55 |
| IUPAC Name | 3,6-ditert-butyl-9-[(R)-(4-tert-butyl-2-methylcyclopentyl)-(4-tert-butylphenyl)methyl]-4b,8a,9,9a-tetrahydro-4aH-fluorene;propane |
| SMILES | CC1CC(C(C)(C)C)CC1[C@@H](c1ccc(C(C)(C)C)cc1)C1C2C=CC(C(C)(C)C)=CC2C2C=C(C(C)(C)C)C=CC21.CCC |
| InChI | InChI=1S/C42H62.C3H8/c1-26-22-31(42(11,12)13)25-34(26)37(27-14-16-28(17-15-27)39(2,3)4)38-32-20-18-29(40(5,6)7)23-35(32)36-24-30(41(8,9)10)19-21-33(36)38;1-3-2/h14-21,23-24,26,31-38H,22,25H2,1-13H3;3H2,1-2H3/t26?,31?,32?,33?,34?,35?,36?,37-,38?;/m1./s1 |
| InChIKey | MWGHDWCIVWWWCQ-KGNMBUMHSA-N |
| XLogP | 13.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.06 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |