C42H54 — CID 59107372
(3aR)-1-[2-[(3aR)-4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]ethyl]-4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 59107372) has the molecular formula C42H54 and a molecular weight of 558.89 g/mol. Its IUPAC name is (3aR)-1-[2-[(3aR)-4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]ethyl]-4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | (3aR)-1-[2-[(3aR)-4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]ethyl]-4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 59107372 |
| Molecular Formula | C42H54 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.42 |
| IUPAC Name | (3aR)-1-[2-[(3aR)-4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]ethyl]-4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CC1C[C@H]2C(c3ccc(C(C)(C)C)cc3)=CC=CC2C1CCC1C(C)C[C@H]2C(c3ccc(C(C)(C)C)cc3)=CC=CC12 |
| InChI | InChI=1S/C42H54/c1-27-25-39-35(29-15-19-31(20-16-29)41(3,4)5)11-9-13-37(39)33(27)23-24-34-28(2)26-40-36(12-10-14-38(34)40)30-17-21-32(22-18-30)42(6,7)8/h9-22,27-28,33-34,37-40H,23-26H2,1-8H3/t27?,28?,33?,34?,37?,38?,39-,40-/m0/s1 |
| InChIKey | PRMXXDJIQNOIMP-UWLDYBCSSA-N |
| XLogP | 11.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |