C43H58OSi — CID 162289724
[4-(4-ethylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-[2-methyl-4-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silane (PubChem CID 162289724) has the molecular formula C43H58OSi and a molecular weight of 619.02 g/mol. Its IUPAC name is [4-(4-ethylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-[2-methyl-4-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silane.
| Compound Name | [4-(4-ethylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-[2-methyl-4-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 162289724 |
| Molecular Formula | C43H58OSi |
| Molecular Weight | 619.02 g/mol |
| Exact Mass | 618.43 |
| IUPAC Name | [4-(4-ethylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-[2-methyl-4-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silane |
| SMILES | CCc1ccc(C2=CC=CC3C2CC(C(C)C)C3[Si](C)(C)C2C(C)CC3C(c4ccc(COC(C)(C)C)cc4)=CC=CC32)cc1 |
| InChI | InChI=1S/C43H58OSi/c1-10-30-17-21-32(22-18-30)35-14-12-16-37-40(35)26-38(28(2)3)42(37)45(8,9)41-29(4)25-39-34(13-11-15-36(39)41)33-23-19-31(20-24-33)27-44-43(5,6)7/h11-24,28-29,36-42H,10,25-27H2,1-9H3 |
| InChIKey | JIQVOXSNBDWMKV-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.02 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|