C39H42Cl2N2SiTi-2 — CID 58634317
[(2S,3aS,7aS)-4-(3-phenylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium (PubChem CID 58634317) has the molecular formula C39H42Cl2N2SiTi-2 and a molecular weight of 685.64 g/mol. Its IUPAC name is [(2S,3aS,7aS)-4-(3-phenylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium.
| Compound Name | [(2S,3aS,7aS)-4-(3-phenylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58634317 |
| Molecular Formula | C39H42Cl2N2SiTi-2 |
| Molecular Weight | 685.64 g/mol |
| Exact Mass | 684.20 |
| IUPAC Name | [(2S,3aS,7aS)-4-(3-phenylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium |
| SMILES | CC(C)[C@@H]1C[C@@H]2C(c3cccc(-c4ccccc4)c3)=CC=C[C@@H]2C1[Si](C)(C)N1c2ccccc2[N-]c2ccccc21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C38H39N2Si.CH3.2ClH.Ti/c1-26(2)32-25-33-30(29-17-12-16-28(24-29)27-14-6-5-7-15-27)18-13-19-31(33)38(32)41(3,4)40-36-22-10-8-20-34(36)39-35-21-9-11-23-37(35)40;;;;/h5-24,26,31-33,38H,25H2,1-4H3;1H3;2*1H;/q2*-1;;;+2/p-2/t31-,32-,33+,38?;;;;/m0..../s1 |
| InChIKey | OAZMBZVFUDXOQW-RQARXVQFSA-L |
| XLogP | 13.11 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.64 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|