C31H35Cl2N3SiTi-2 — CID 58634129
[(4aR,6R,7aS)-6-ethyl-4-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-7-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium (PubChem CID 58634129) has the molecular formula C31H35Cl2N3SiTi-2 and a molecular weight of 596.50 g/mol. Its IUPAC name is [(4aR,6R,7aS)-6-ethyl-4-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-7-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium.
| Compound Name | [(4aR,6R,7aS)-6-ethyl-4-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-7-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58634129 |
| Molecular Formula | C31H35Cl2N3SiTi-2 |
| Molecular Weight | 596.50 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | [(4aR,6R,7aS)-6-ethyl-4-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-7-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium |
| SMILES | CC[C@@H]1C[C@@H]2C(c3ccccc3)=CC=N[C@@H]2C1[Si](C)(C)N1c2ccccc2[N-]c2ccccc21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C30H32N3Si.CH3.2ClH.Ti/c1-4-21-20-24-23(22-12-6-5-7-13-22)18-19-31-29(24)30(21)34(2,3)33-27-16-10-8-14-25(27)32-26-15-9-11-17-28(26)33;;;;/h5-19,21,24,29-30H,4,20H2,1-3H3;1H3;2*1H;/q2*-1;;;+2/p-2/t21-,24-,29+,30?;;;;/m1..../s1 |
| InChIKey | FZKJNKCWYQAGIN-JKIRIBKCSA-L |
| XLogP | 10.46 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.50 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|